C14H23F11NO3S+ — CID 175158565
tetraethylazanium;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid (PubChem CID 175158565) has the molecular formula C14H23F11NO3S+ and a molecular weight of 494.39 g/mol. Its IUPAC name is tetraethylazanium;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid.
| Compound Name | tetraethylazanium;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 175158565 |
| Molecular Formula | C14H23F11NO3S+ |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | tetraethylazanium;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C8H20N.C6H3F11O3S/c1-5-9(6-2,7-3)8-4;7-2(8,1-3(9,10)11)4(12,13)5(14,15)6(16,17)21(18,19)20/h5-8H2,1-4H3;1H2,(H,18,19,20)/q+1; |
| InChIKey | DTRPRDPRJXIDAA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|