C12H14F15NO3S — CID 175159561
azane;1,1,2,2,3,3,4,4,5,5,6,6,12,12,12-pentadecafluorododecane-1-sulfonic acid (PubChem CID 175159561) has the molecular formula C12H14F15NO3S and a molecular weight of 537.29 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,4,4,5,5,6,6,12,12,12-pentadecafluorododecane-1-sulfonic acid.
| Compound Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,12,12,12-pentadecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 175159561 |
| Molecular Formula | C12H14F15NO3S |
| Molecular Weight | 537.29 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,12,12,12-pentadecafluorododecane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C12H11F15O3S.H3N/c13-6(14,4-2-1-3-5-7(15,16)17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)31(28,29)30;/h1-5H2,(H,28,29,30);1H3 |
| InChIKey | NMVXUQYXZSHUSG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.29 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|