C11H10F13NaO3S — CID 141492470
sodium 1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoroundecane-1-sulfonate (PubChem CID 141492470) has the molecular formula C11H10F13NaO3S and a molecular weight of 492.23 g/mol. Its IUPAC name is sodium 1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoroundecane-1-sulfonate.
| Compound Name | sodium 1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 141492470 |
| Molecular Formula | C11H10F13NaO3S |
| Molecular Weight | 492.23 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | sodium 1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoroundecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCC(F)(F)F.[Na+] |
| InChI | InChI=1S/C11H11F13O3S.Na/c12-6(13,4-2-1-3-5-7(14,15)16)8(17,18)9(19,20)10(21,22)11(23,24)28(25,26)27;/h1-5H2,(H,25,26,27);/q;+1/p-1 |
| InChIKey | GDDMMBANYSKANY-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|