C11H16F7O3S- — CID 154492518
1,1,2,2,11,11,11-heptafluoroundecane-1-sulfonate (PubChem CID 154492518) has the molecular formula C11H16F7O3S- and a molecular weight of 361.30 g/mol. Its IUPAC name is 1,1,2,2,11,11,11-heptafluoroundecane-1-sulfonate.
| Compound Name | 1,1,2,2,11,11,11-heptafluoroundecane-1-sulfonate |
|---|---|
| PubChem CID | 154492518 |
| Molecular Formula | C11H16F7O3S- |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1,1,2,2,11,11,11-heptafluoroundecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H17F7O3S/c12-9(13,11(17,18)22(19,20)21)7-5-3-1-2-4-6-8-10(14,15)16/h1-8H2,(H,19,20,21)/p-1 |
| InChIKey | LNHXVFCGOHDKFH-UHFFFAOYSA-M |
| XLogP | 4.44 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|