C14H16F9NO3S — CID 141492302
1,1,2,2,3,3,9,9,9-nonafluorononane-1-sulfonate;pyridin-1-ium (PubChem CID 141492302) has the molecular formula C14H16F9NO3S and a molecular weight of 449.34 g/mol. Its IUPAC name is 1,1,2,2,3,3,9,9,9-nonafluorononane-1-sulfonate;pyridin-1-ium.
| Compound Name | 1,1,2,2,3,3,9,9,9-nonafluorononane-1-sulfonate;pyridin-1-ium |
|---|---|
| PubChem CID | 141492302 |
| Molecular Formula | C14H16F9NO3S |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 1,1,2,2,3,3,9,9,9-nonafluorononane-1-sulfonate;pyridin-1-ium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)CCCCCC(F)(F)F.c1cc[nH+]cc1 |
| InChI | InChI=1S/C9H11F9O3S.C5H5N/c10-6(11,4-2-1-3-5-7(12,13)14)8(15,16)9(17,18)22(19,20)21;1-2-4-6-5-3-1/h1-5H2,(H,19,20,21);1-5H |
| InChIKey | IYUASYUILMYLNF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|