C14H12F13NO3S — CID 141492585
pyridin-1-ium;1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane-1-sulfonate (PubChem CID 141492585) has the molecular formula C14H12F13NO3S and a molecular weight of 521.30 g/mol. Its IUPAC name is pyridin-1-ium;1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane-1-sulfonate.
| Compound Name | pyridin-1-ium;1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane-1-sulfonate |
|---|---|
| PubChem CID | 141492585 |
| Molecular Formula | C14H12F13NO3S |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | pyridin-1-ium;1,1,2,2,3,3,4,4,5,5,9,9,9-tridecafluorononane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(F)(F)F.c1cc[nH+]cc1 |
| InChI | InChI=1S/C9H7F13O3S.C5H5N/c10-4(11,2-1-3-5(12,13)14)6(15,16)7(17,18)8(19,20)9(21,22)26(23,24)25;1-2-4-6-5-3-1/h1-3H2,(H,23,24,25);1-5H |
| InChIKey | ZOJZKTZNDNOISR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|