C14H22F3NO3S — CID 134207498
pyridin-1-ium;9,9,9-trifluorononane-1-sulfonate (PubChem CID 134207498) has the molecular formula C14H22F3NO3S and a molecular weight of 341.39 g/mol. Its IUPAC name is pyridin-1-ium;9,9,9-trifluorononane-1-sulfonate.
| Compound Name | pyridin-1-ium;9,9,9-trifluorononane-1-sulfonate |
|---|---|
| PubChem CID | 134207498 |
| Molecular Formula | C14H22F3NO3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | pyridin-1-ium;9,9,9-trifluorononane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCCCCCC(F)(F)F.c1cc[nH+]cc1 |
| InChI | InChI=1S/C9H17F3O3S.C5H5N/c10-9(11,12)7-5-3-1-2-4-6-8-16(13,14)15;1-2-4-6-5-3-1/h1-8H2,(H,13,14,15);1-5H |
| InChIKey | JTEIIIOZFROZFF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|