About hexane-1-sulfonate;pyridin-1-ium
hexane-1-sulfonate;pyridin-1-ium (PubChem CID 122481615) has the molecular formula C11H19NO3S
and a molecular weight of 245.34 g/mol. Its IUPAC name is hexane-1-sulfonate;pyridin-1-ium.
Molecular Properties
| Compound Name | hexane-1-sulfonate;pyridin-1-ium |
| PubChem CID | 122481615 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | hexane-1-sulfonate;pyridin-1-ium |
| SMILES | CCCCCCS(=O)(=O)[O-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C6H14O3S.C5H5N/c1-2-3-4-5-6-10(7,8)9;1-2-4-6-5-3-1/h2-6H2,1H3,(H,7,8,9);1-5H |
| InChIKey | IHOZGKMHOIVZNU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hexane-1-sulfonate;pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1-sulfonate;pyridin-1-ium?
The IUPAC name of hexane-1-sulfonate;pyridin-1-ium (CID 122481615) is hexane-1-sulfonate;pyridin-1-ium.
What is the SMILES notation for hexane-1-sulfonate;pyridin-1-ium?
The canonical SMILES for hexane-1-sulfonate;pyridin-1-ium is CCCCCCS(=O)(=O)[O-].c1cc[nH+]cc1.
What is the InChIKey of hexane-1-sulfonate;pyridin-1-ium?
The InChIKey is IHOZGKMHOIVZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3S.C5H5N/c1-2-3-4-5-6-10(7,8)9;1-2-4-6-5-3-1/h2-6H2,1H3,(H,7,8,9);1-5H.
What are the key properties of hexane-1-sulfonate;pyridin-1-ium?
hexane-1-sulfonate;pyridin-1-ium has a molecular weight of 245.34 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1-sulfonate;pyridin-1-ium is sourced from PubChem (CID 122481615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).