About decane-1-sulfonate;pyridin-1-ium
decane-1-sulfonate;pyridin-1-ium (PubChem CID 122481242) has the molecular formula C15H27NO3S
and a molecular weight of 301.45 g/mol. Its IUPAC name is decane-1-sulfonate;pyridin-1-ium.
Molecular Properties
| Compound Name | decane-1-sulfonate;pyridin-1-ium |
| PubChem CID | 122481242 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | decane-1-sulfonate;pyridin-1-ium |
| SMILES | CCCCCCCCCCS(=O)(=O)[O-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C10H22O3S.C5H5N/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;1-2-4-6-5-3-1/h2-10H2,1H3,(H,11,12,13);1-5H |
| InChIKey | UYSFYOPXPLIBQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze decane-1-sulfonate;pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-1-sulfonate;pyridin-1-ium?
The IUPAC name of decane-1-sulfonate;pyridin-1-ium (CID 122481242) is decane-1-sulfonate;pyridin-1-ium.
What is the SMILES notation for decane-1-sulfonate;pyridin-1-ium?
The canonical SMILES for decane-1-sulfonate;pyridin-1-ium is CCCCCCCCCCS(=O)(=O)[O-].c1cc[nH+]cc1.
What is the InChIKey of decane-1-sulfonate;pyridin-1-ium?
The InChIKey is UYSFYOPXPLIBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3S.C5H5N/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;1-2-4-6-5-3-1/h2-10H2,1H3,(H,11,12,13);1-5H.
What are the key properties of decane-1-sulfonate;pyridin-1-ium?
decane-1-sulfonate;pyridin-1-ium has a molecular weight of 301.45 g/mol, XLogP of 3.17, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decane-1-sulfonate;pyridin-1-ium is sourced from PubChem (CID 122481242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).