About CID 172823664
CID 172823664 (PubChem CID 172823664) has the molecular formula C8H13NNaO3S
and a molecular weight of 226.25 g/mol.
Molecular Properties
| Compound Name | CID 172823664 |
| PubChem CID | 172823664 |
| Molecular Formula | C8H13NNaO3S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | — |
| SMILES | CCCS(=O)(=O)[O-].[Na].c1cc[nH+]cc1 |
| InChI | InChI=1S/C5H5N.C3H8O3S.Na/c1-2-4-6-5-3-1;1-2-3-7(4,5)6;/h1-5H;2-3H2,1H3,(H,4,5,6); |
| InChIKey | UOIBDPBAZXAMJP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 172823664 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172823664?
The IUPAC name of CID 172823664 (CID 172823664) is not available.
What is the SMILES notation for CID 172823664?
The canonical SMILES for CID 172823664 is CCCS(=O)(=O)[O-].[Na].c1cc[nH+]cc1.
What is the InChIKey of CID 172823664?
The InChIKey is UOIBDPBAZXAMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C3H8O3S.Na/c1-2-4-6-5-3-1;1-2-3-7(4,5)6;/h1-5H;2-3H2,1H3,(H,4,5,6);.
What are the key properties of CID 172823664?
CID 172823664 has a molecular weight of 226.25 g/mol, XLogP of 0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172823664 is sourced from PubChem (CID 172823664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).