About pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate
pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate (PubChem CID 134206718) has the molecular formula C12H18F3NO3S
and a molecular weight of 313.34 g/mol. Its IUPAC name is pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate.
Molecular Properties
| Compound Name | pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate |
| PubChem CID | 134206718 |
| Molecular Formula | C12H18F3NO3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCCCC(F)(F)F.c1cc[nH+]cc1 |
| InChI | InChI=1S/C7H13F3O3S.C5H5N/c8-7(9,10)5-3-1-2-4-6-14(11,12)13;1-2-4-6-5-3-1/h1-6H2,(H,11,12,13);1-5H |
| InChIKey | QGZOACJTMPNPHK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate?
The IUPAC name of pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate (CID 134206718) is pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate.
What is the SMILES notation for pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate?
The canonical SMILES for pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate is O=S(=O)([O-])CCCCCCC(F)(F)F.c1cc[nH+]cc1.
What is the InChIKey of pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate?
The InChIKey is QGZOACJTMPNPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3O3S.C5H5N/c8-7(9,10)5-3-1-2-4-6-14(11,12)13;1-2-4-6-5-3-1/h1-6H2,(H,11,12,13);1-5H.
What are the key properties of pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate?
pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate has a molecular weight of 313.34 g/mol, XLogP of 2.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium;7,7,7-trifluoroheptane-1-sulfonate is sourced from PubChem (CID 134206718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).