C16H16F3IO3S — CID 158571803
diphenyliodanium;4,4,4-trifluorobutane-1-sulfonate (PubChem CID 158571803) has the molecular formula C16H16F3IO3S and a molecular weight of 472.27 g/mol. Its IUPAC name is diphenyliodanium;4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | diphenyliodanium;4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 158571803 |
| Molecular Formula | C16H16F3IO3S |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | diphenyliodanium;4,4,4-trifluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCC(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.C4H7F3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-4(6,7)2-1-3-11(8,9)10/h1-10H;1-3H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | HSEAPJYYONWLCG-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|