C16H13F6IO3S — CID 22625512
1,1,2,3,3,3-hexafluoropropane-1-sulfonate;(4-methylphenyl)-phenyliodanium (PubChem CID 22625512) has the molecular formula C16H13F6IO3S and a molecular weight of 526.24 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;(4-methylphenyl)-phenyliodanium.
| Compound Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;(4-methylphenyl)-phenyliodanium |
|---|---|
| PubChem CID | 22625512 |
| Molecular Formula | C16H13F6IO3S |
| Molecular Weight | 526.24 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoropropane-1-sulfonate;(4-methylphenyl)-phenyliodanium |
| SMILES | Cc1ccc([I+]c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C13H12I.C3H2F6O3S/c1-11-7-9-13(10-8-11)14-12-5-3-2-4-6-12;4-1(2(5,6)7)3(8,9)13(10,11)12/h2-10H,1H3;1H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | TXGPIWNAROKVBE-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|