C5H8F6O3S2 — CID 161156504
dimethylsulfanium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate (PubChem CID 161156504) has the molecular formula C5H8F6O3S2 and a molecular weight of 294.24 g/mol. Its IUPAC name is dimethylsulfanium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | dimethylsulfanium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 161156504 |
| Molecular Formula | C5H8F6O3S2 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | dimethylsulfanium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate |
| SMILES | C[SH+]C.O=S(=O)([O-])C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6O3S.C2H6S/c4-1(2(5,6)7)3(8,9)13(10,11)12;1-3-2/h1H,(H,10,11,12);1-2H3 |
| InChIKey | UPJASGYTCATISO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|