C8HF16NaO3S — CID 141492086
sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluorooctane-1-sulfonate (PubChem CID 141492086) has the molecular formula C8HF16NaO3S and a molecular weight of 504.12 g/mol. Its IUPAC name is sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluorooctane-1-sulfonate.
| Compound Name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 141492086 |
| Molecular Formula | C8HF16NaO3S |
| Molecular Weight | 504.12 g/mol |
| Exact Mass | 503.93 |
| IUPAC Name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H2F16O3S.Na/c9-1(3(12,13)14)2(10,11)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)28(25,26)27;/h1H,(H,25,26,27);/q;+1/p-1 |
| InChIKey | ZOPASNGEELQDGZ-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.12 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|