C6H4F9LiO3S — CID 122481409
lithium 1,1,2,2,3,3,4,4,5-nonafluorohexane-1-sulfonate (PubChem CID 122481409) has the molecular formula C6H4F9LiO3S and a molecular weight of 334.09 g/mol. Its IUPAC name is lithium 1,1,2,2,3,3,4,4,5-nonafluorohexane-1-sulfonate.
| Compound Name | lithium 1,1,2,2,3,3,4,4,5-nonafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 122481409 |
| Molecular Formula | C6H4F9LiO3S |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | lithium 1,1,2,2,3,3,4,4,5-nonafluorohexane-1-sulfonate |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C6H5F9O3S.Li/c1-2(7)3(8,9)4(10,11)5(12,13)6(14,15)19(16,17)18;/h2H,1H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | SCIFJAMAIBYKQF-UHFFFAOYSA-M |
| XLogP | -0.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|