C4H4F5KO3S — CID 122480963
potassium 1,1,2,2,3-pentafluorobutane-1-sulfonate (PubChem CID 122480963) has the molecular formula C4H4F5KO3S and a molecular weight of 266.23 g/mol. Its IUPAC name is potassium 1,1,2,2,3-pentafluorobutane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3-pentafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 122480963 |
| Molecular Formula | C4H4F5KO3S |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | potassium 1,1,2,2,3-pentafluorobutane-1-sulfonate |
| SMILES | CC(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C4H5F5O3S.K/c1-2(5)3(6,7)4(8,9)13(10,11)12;/h2H,1H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | CMWLHUCXYAVSSD-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|