C4HF8KO3S — CID 141492476
potassium 1,1,2,2,3,4,4,4-octafluorobutane-1-sulfonate (PubChem CID 141492476) has the molecular formula C4HF8KO3S and a molecular weight of 320.20 g/mol. Its IUPAC name is potassium 1,1,2,2,3,4,4,4-octafluorobutane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3,4,4,4-octafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141492476 |
| Molecular Formula | C4HF8KO3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | potassium 1,1,2,2,3,4,4,4-octafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C4H2F8O3S.K/c5-1(3(8,9)10)2(6,7)4(11,12)16(13,14)15;/h1H,(H,13,14,15);/q;+1/p-1 |
| InChIKey | WKMHPUAMEJMTIQ-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|