C2F5O3S- — CID 22062497
1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 22062497) has the molecular formula C2F5O3S- and a molecular weight of 199.08 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 22062497 |
| Molecular Formula | C2F5O3S- |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.95 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C2HF5O3S/c3-1(4,5)2(6,7)11(8,9)10/h(H,8,9,10)/p-1 |
| InChIKey | GKNWQHIXXANPTN-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|