C5H4F7NaO3S — CID 122480955
sodium 1,1,2,2,3,3,4-heptafluoropentane-1-sulfonate (PubChem CID 122480955) has the molecular formula C5H4F7NaO3S and a molecular weight of 300.13 g/mol. Its IUPAC name is sodium 1,1,2,2,3,3,4-heptafluoropentane-1-sulfonate.
| Compound Name | sodium 1,1,2,2,3,3,4-heptafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 122480955 |
| Molecular Formula | C5H4F7NaO3S |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | sodium 1,1,2,2,3,3,4-heptafluoropentane-1-sulfonate |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H5F7O3S.Na/c1-2(6)3(7,8)4(9,10)5(11,12)16(13,14)15;/h2H,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | WXEBEEBVPBADKS-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|