C8H4F13NaO3S — CID 122480897
sodium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane-1-sulfonate (PubChem CID 122480897) has the molecular formula C8H4F13NaO3S and a molecular weight of 450.15 g/mol. Its IUPAC name is sodium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane-1-sulfonate.
| Compound Name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 122480897 |
| Molecular Formula | C8H4F13NaO3S |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | sodium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane-1-sulfonate |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H5F13O3S.Na/c1-2(9)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)25(22,23)24;/h2H,1H3,(H,22,23,24);/q;+1/p-1 |
| InChIKey | LNULNFHQLOUXNK-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|