C10H15F5N2O3S — CID 142680828
1-ethyl-3-methylimidazol-3-ium;1,1,2,2,3-pentafluorobutane-1-sulfonate (PubChem CID 142680828) has the molecular formula C10H15F5N2O3S and a molecular weight of 338.30 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;1,1,2,2,3-pentafluorobutane-1-sulfonate.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;1,1,2,2,3-pentafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 142680828 |
| Molecular Formula | C10H15F5N2O3S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;1,1,2,2,3-pentafluorobutane-1-sulfonate |
| SMILES | CC(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C6H11N2.C4H5F5O3S/c1-3-8-5-4-7(2)6-8;1-2(5)3(6,7)4(8,9)13(10,11)12/h4-6H,3H2,1-2H3;2H,1H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | ASQVEBFXJJOQMG-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|