C6H13N2O5S2+ — CID 160555581
1-ethyl-3-methylimidazol-3-ium;sulfuric acid;sulfur monoxide (PubChem CID 160555581) has the molecular formula C6H13N2O5S2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;sulfuric acid;sulfur monoxide.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;sulfuric acid;sulfur monoxide |
|---|---|
| PubChem CID | 160555581 |
| Molecular Formula | C6H13N2O5S2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;sulfuric acid;sulfur monoxide |
| SMILES | CCn1cc[n+](C)c1.O=S.O=S(=O)(O)O |
| InChI | InChI=1S/C6H11N2.H2O4S.OS/c1-3-8-5-4-7(2)6-8;1-5(2,3)4;1-2/h4-6H,3H2,1-2H3;(H2,1,2,3,4);/q+1;; |
| InChIKey | AIYYCAQNIOTKFU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|