About 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid
1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid (PubChem CID 173195338) has the molecular formula C6H23F6N2O18P6+
and a molecular weight of 711.08 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid |
| PubChem CID | 173195338 |
| Molecular Formula | C6H23F6N2O18P6+ |
| Molecular Weight | 711.08 g/mol |
| Exact Mass | 710.93 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid |
| SMILES | CCn1cc[n+](C)c1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F |
| InChI | InChI=1S/C6H11N2.6FH2O3P/c1-3-8-5-4-7(2)6-8;6*1-5(2,3)4/h4-6H,3H2,1-2H3;6*(H2,2,3,4)/q+1;;;;;; |
| InChIKey | HCIYMPUTWHLXJC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 353.99 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.08 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid (CID 173195338) is 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid is CCn1cc[n+](C)c1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid?
The InChIKey is HCIYMPUTWHLXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2.6FH2O3P/c1-3-8-5-4-7(2)6-8;6*1-5(2,3)4/h4-6H,3H2,1-2H3;6*(H2,2,3,4)/q+1;;;;;;.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid?
1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid has a molecular weight of 711.08 g/mol, XLogP of 0.62, 1 rotatable bonds, 12 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;fluorophosphonic acid is sourced from PubChem (CID 173195338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).