C14H27FN5O3P — CID 178182737
bis(1-ethyl-3-methylimidazol-3-ium);1-fluoro-N-methyl-N-phosphonatomethanamine (PubChem CID 178182737) has the molecular formula C14H27FN5O3P and a molecular weight of 363.37 g/mol. Its IUPAC name is bis(1-ethyl-3-methylimidazol-3-ium);1-fluoro-N-methyl-N-phosphonatomethanamine.
| Compound Name | bis(1-ethyl-3-methylimidazol-3-ium);1-fluoro-N-methyl-N-phosphonatomethanamine |
|---|---|
| PubChem CID | 178182737 |
| Molecular Formula | C14H27FN5O3P |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | bis(1-ethyl-3-methylimidazol-3-ium);1-fluoro-N-methyl-N-phosphonatomethanamine |
| SMILES | CCn1cc[n+](C)c1.CCn1cc[n+](C)c1.CN(CF)P(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H11N2.C2H7FNO3P/c2*1-3-8-5-4-7(2)6-8;1-4(2-3)8(5,6)7/h2*4-6H,3H2,1-2H3;2H2,1H3,(H2,5,6,7)/q2*+1;/p-2 |
| InChIKey | ICOFSMITCJMHCT-UHFFFAOYSA-L |
| XLogP | -0.66 |
| TPSA | 84.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|