About 1-ethyl-3-methylimidazol-3-ium;trihydroiodide
1-ethyl-3-methylimidazol-3-ium;trihydroiodide (PubChem CID 175038579) has the molecular formula C6H14I3N2+
and a molecular weight of 494.90 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;trihydroiodide.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;trihydroiodide |
| PubChem CID | 175038579 |
| Molecular Formula | C6H14I3N2+ |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.83 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;trihydroiodide |
| SMILES | CCn1cc[n+](C)c1.I.I.I |
| InChI | InChI=1S/C6H11N2.3HI/c1-3-8-5-4-7(2)6-8;;;/h4-6H,3H2,1-2H3;3*1H/q+1;;; |
| InChIKey | JMVKEQGTQZVOOD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;trihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;trihydroiodide?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;trihydroiodide (CID 175038579) is 1-ethyl-3-methylimidazol-3-ium;trihydroiodide.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;trihydroiodide?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;trihydroiodide is CCn1cc[n+](C)c1.I.I.I.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;trihydroiodide?
The InChIKey is JMVKEQGTQZVOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2.3HI/c1-3-8-5-4-7(2)6-8;;;/h4-6H,3H2,1-2H3;3*1H/q+1;;;.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;trihydroiodide?
1-ethyl-3-methylimidazol-3-ium;trihydroiodide has a molecular weight of 494.90 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;trihydroiodide is sourced from PubChem (CID 175038579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).