About 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride
1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride (PubChem CID 88517074) has the molecular formula C10H16ClN5
and a molecular weight of 241.73 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride |
| PubChem CID | 88517074 |
| Molecular Formula | C10H16ClN5 |
| Molecular Weight | 241.73 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride |
| SMILES | CCn1cc[n+](C)c1.Nc1ncccn1.[Cl-] |
| InChI | InChI=1S/C6H11N2.C4H5N3.ClH/c1-3-8-5-4-7(2)6-8;5-4-6-2-1-3-7-4;/h4-6H,3H2,1-2H3;1-3H,(H2,5,6,7);1H/q+1;;/p-1 |
| InChIKey | DHSVAIPEVIOCTA-UHFFFAOYSA-M |
| XLogP | -2.60 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.73 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride (CID 88517074) is 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride is CCn1cc[n+](C)c1.Nc1ncccn1.[Cl-].
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride?
The InChIKey is DHSVAIPEVIOCTA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.C4H5N3.ClH/c1-3-8-5-4-7(2)6-8;5-4-6-2-1-3-7-4;/h4-6H,3H2,1-2H3;1-3H,(H2,5,6,7);1H/q+1;;/p-1.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride?
1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride has a molecular weight of 241.73 g/mol, XLogP of -2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;pyrimidin-2-amine;chloride is sourced from PubChem (CID 88517074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).