About 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride
1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride (PubChem CID 174881493) has the molecular formula C9H16Cl2N4
and a molecular weight of 251.16 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride |
| PubChem CID | 174881493 |
| Molecular Formula | C9H16Cl2N4 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride |
| SMILES | CCn1cc[n+](C)c1.Cl.[Cl-].c1c[nH]cn1 |
| InChI | InChI=1S/C6H11N2.C3H4N2.2ClH/c1-3-8-5-4-7(2)6-8;1-2-5-3-4-1;;/h4-6H,3H2,1-2H3;1-3H,(H,4,5);2*1H/q+1;;;/p-1 |
| InChIKey | IECMDJJSUPSSCO-UHFFFAOYSA-M |
| XLogP | -1.83 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride (CID 174881493) is 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride is CCn1cc[n+](C)c1.Cl.[Cl-].c1c[nH]cn1.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride?
The InChIKey is IECMDJJSUPSSCO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.C3H4N2.2ClH/c1-3-8-5-4-7(2)6-8;1-2-5-3-4-1;;/h4-6H,3H2,1-2H3;1-3H,(H,4,5);2*1H/q+1;;;/p-1.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride?
1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride has a molecular weight of 251.16 g/mol, XLogP of -1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;1H-imidazole;chloride;hydrochloride is sourced from PubChem (CID 174881493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).