About dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium
dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium (PubChem CID 173491123) has the molecular formula C8H13BN4
and a molecular weight of 176.03 g/mol. Its IUPAC name is dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium |
| PubChem CID | 173491123 |
| Molecular Formula | C8H13BN4 |
| Molecular Weight | 176.03 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1.N#C[BH2-]C#N |
| InChI | InChI=1S/C6H11N2.C2H2BN2/c1-3-8-5-4-7(2)6-8;4-1-3-2-5/h4-6H,3H2,1-2H3;3H2/q+1;-1 |
| InChIKey | XALQVTCIMOPTGD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 56.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.03 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium?
The IUPAC name of dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium (CID 173491123) is dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium.
What is the SMILES notation for dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium?
The canonical SMILES for dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium is CCn1cc[n+](C)c1.N#C[BH2-]C#N.
What is the InChIKey of dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium?
The InChIKey is XALQVTCIMOPTGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2.C2H2BN2/c1-3-8-5-4-7(2)6-8;4-1-3-2-5/h4-6H,3H2,1-2H3;3H2/q+1;-1.
What are the key properties of dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium?
dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium has a molecular weight of 176.03 g/mol, XLogP of -0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicyanoboranuide;1-ethyl-3-methylimidazol-3-ium is sourced from PubChem (CID 173491123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).