C7H11N3O2SSe — CID 87293185
CID 87293185 (PubChem CID 87293185) has the molecular formula C7H11N3O2SSe and a molecular weight of 280.21 g/mol.
| Compound Name | CID 87293185 |
|---|---|
| PubChem CID | 87293185 |
| Molecular Formula | C7H11N3O2SSe |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | — |
| SMILES | CCn1cc[n+](C)c1.N#C[Se](=O)([O-])=S |
| InChI | InChI=1S/C6H11N2.CHNO2SSe/c1-3-8-5-4-7(2)6-8;2-1-6(3,4)5/h4-6H,3H2,1-2H3;(H,3,4,5)/q+1;/p-1 |
| InChIKey | SZMUPWUTNCCEOP-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 72.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|