About azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile
azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile (PubChem CID 175296554) has the molecular formula C8H14N5+
and a molecular weight of 180.23 g/mol. Its IUPAC name is azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile.
Molecular Properties
| Compound Name | azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile |
| PubChem CID | 175296554 |
| Molecular Formula | C8H14N5+ |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile |
| SMILES | CCn1cc[n+](C)c1.N.N#CC#N |
| InChI | InChI=1S/C6H11N2.C2N2.H3N/c1-3-8-5-4-7(2)6-8;3-1-2-4;/h4-6H,3H2,1-2H3;;1H3/q+1;; |
| InChIKey | FWIHKRVIHZNXOZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile?
The IUPAC name of azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile (CID 175296554) is azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile.
What is the SMILES notation for azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile?
The canonical SMILES for azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile is CCn1cc[n+](C)c1.N.N#CC#N.
What is the InChIKey of azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile?
The InChIKey is FWIHKRVIHZNXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2.C2N2.H3N/c1-3-8-5-4-7(2)6-8;3-1-2-4;/h4-6H,3H2,1-2H3;;1H3/q+1;;.
What are the key properties of azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile?
azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile has a molecular weight of 180.23 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethyl-3-methylimidazol-3-ium;oxalonitrile is sourced from PubChem (CID 175296554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).