C9H18N3O2+ — CID 87299363
(2S)-2-aminopropanoic acid;1-ethyl-3-methylimidazol-3-ium (PubChem CID 87299363) has the molecular formula C9H18N3O2+ and a molecular weight of 200.26 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;1-ethyl-3-methylimidazol-3-ium.
| Compound Name | (2S)-2-aminopropanoic acid;1-ethyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 87299363 |
| Molecular Formula | C9H18N3O2+ |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2S)-2-aminopropanoic acid;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11N2.C3H7NO2/c1-3-8-5-4-7(2)6-8;1-2(4)3(5)6/h4-6H,3H2,1-2H3;2H,4H2,1H3,(H,5,6)/q+1;/t;2-/m.0/s1 |
| InChIKey | NJYVKYFXBDKITN-WNQIDUERSA-N |
| XLogP | -0.25 |
| TPSA | 72.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|