C11H20N3O4+ — CID 175019180
2-aminopentanedioic acid;1-ethyl-3-methylimidazol-3-ium (PubChem CID 175019180) has the molecular formula C11H20N3O4+ and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-aminopentanedioic acid;1-ethyl-3-methylimidazol-3-ium.
| Compound Name | 2-aminopentanedioic acid;1-ethyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 175019180 |
| Molecular Formula | C11H20N3O4+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-aminopentanedioic acid;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11N2.C5H9NO4/c1-3-8-5-4-7(2)6-8;6-3(5(9)10)1-2-4(7)8/h4-6H,3H2,1-2H3;3H,1-2,6H2,(H,7,8)(H,9,10)/q+1; |
| InChIKey | UFAWJLREKRHGOH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|