C11H21N4O4+ — CID 175140991
2-aminobutanedioic acid;1-(3-methylimidazol-3-ium-1-yl)propan-1-amine (PubChem CID 175140991) has the molecular formula C11H21N4O4+ and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-aminobutanedioic acid;1-(3-methylimidazol-3-ium-1-yl)propan-1-amine.
| Compound Name | 2-aminobutanedioic acid;1-(3-methylimidazol-3-ium-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 175140991 |
| Molecular Formula | C11H21N4O4+ |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-aminobutanedioic acid;1-(3-methylimidazol-3-ium-1-yl)propan-1-amine |
| SMILES | CCC(N)n1cc[n+](C)c1.NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N3.C4H7NO4/c1-3-7(8)10-5-4-9(2)6-10;5-2(4(8)9)1-3(6)7/h4-7H,3,8H2,1-2H3;2H,1,5H2,(H,6,7)(H,8,9)/q+1; |
| InChIKey | YJVVNESYOHLCQS-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|