C16H29N5O4+2 — CID 175029710
(2S)-2-aminobutanedioic acid;bis(1-ethyl-3-methylimidazol-3-ium) (PubChem CID 175029710) has the molecular formula C16H29N5O4+2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;bis(1-ethyl-3-methylimidazol-3-ium).
| Compound Name | (2S)-2-aminobutanedioic acid;bis(1-ethyl-3-methylimidazol-3-ium) |
|---|---|
| PubChem CID | 175029710 |
| Molecular Formula | C16H29N5O4+2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;bis(1-ethyl-3-methylimidazol-3-ium) |
| SMILES | CCn1cc[n+](C)c1.CCn1cc[n+](C)c1.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C6H11N2.C4H7NO4/c2*1-3-8-5-4-7(2)6-8;5-2(4(8)9)1-3(6)7/h2*4-6H,3H2,1-2H3;2H,1,5H2,(H,6,7)(H,8,9)/q2*+1;/t;;2-/m..0/s1 |
| InChIKey | RZNZPDIFIFVGPM-VAGRMJETSA-N |
| XLogP | -0.46 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|