C19H35N7O4 — CID 175133607
2-aminopentanedioate;bis(1-(3-methylimidazol-3-ium-1-yl)propan-1-amine) (PubChem CID 175133607) has the molecular formula C19H35N7O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-aminopentanedioate;bis(1-(3-methylimidazol-3-ium-1-yl)propan-1-amine).
| Compound Name | 2-aminopentanedioate;bis(1-(3-methylimidazol-3-ium-1-yl)propan-1-amine) |
|---|---|
| PubChem CID | 175133607 |
| Molecular Formula | C19H35N7O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 2-aminopentanedioate;bis(1-(3-methylimidazol-3-ium-1-yl)propan-1-amine) |
| SMILES | CCC(N)n1cc[n+](C)c1.CCC(N)n1cc[n+](C)c1.NC(CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/2C7H14N3.C5H9NO4/c2*1-3-7(8)10-5-4-9(2)6-10;6-3(5(9)10)1-2-4(7)8/h2*4-7H,3,8H2,1-2H3;3H,1-2,6H2,(H,7,8)(H,9,10)/q2*+1;/p-2 |
| InChIKey | KXVDUBHDQLGTQS-UHFFFAOYSA-L |
| XLogP | -3.05 |
| TPSA | 175.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|