C17H33N4O3P — CID 153326203
dioxido-oxo-pentyl-λ5-phosphane;bis(1-ethyl-3-methylimidazol-3-ium) (PubChem CID 153326203) has the molecular formula C17H33N4O3P and a molecular weight of 372.45 g/mol. Its IUPAC name is dioxido-oxo-pentyl-λ5-phosphane;bis(1-ethyl-3-methylimidazol-3-ium).
| Compound Name | dioxido-oxo-pentyl-λ5-phosphane;bis(1-ethyl-3-methylimidazol-3-ium) |
|---|---|
| PubChem CID | 153326203 |
| Molecular Formula | C17H33N4O3P |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | dioxido-oxo-pentyl-λ5-phosphane;bis(1-ethyl-3-methylimidazol-3-ium) |
| SMILES | CCCCCP(=O)([O-])[O-].CCn1cc[n+](C)c1.CCn1cc[n+](C)c1 |
| InChI | InChI=1S/2C6H11N2.C5H13O3P/c2*1-3-8-5-4-7(2)6-8;1-2-3-4-5-9(6,7)8/h2*4-6H,3H2,1-2H3;2-5H2,1H3,(H2,6,7,8)/q2*+1;/p-2 |
| InChIKey | LMLXRYSSKQAMDH-UHFFFAOYSA-L |
| XLogP | 0.76 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|