C10H8F13KO3S — CID 122481694
potassium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorodecane-1-sulfonate (PubChem CID 122481694) has the molecular formula C10H8F13KO3S and a molecular weight of 494.31 g/mol. Its IUPAC name is potassium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorodecane-1-sulfonate.
| Compound Name | potassium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 122481694 |
| Molecular Formula | C10H8F13KO3S |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | potassium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorodecane-1-sulfonate |
| SMILES | CCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C10H9F13O3S.K/c1-2-3-4(11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)27(24,25)26;/h4H,2-3H2,1H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | GRLYBNHEODEAFB-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|