potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide

C3H2F6KNO2S — CID 173133897

IUPACpotassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)C(F)(F)C(F)C(F)(F)F
InChIInChI=1S/C3H2F6NO2S.K/c4-1(2(5,6)7)3(8,9)13(10,11)12;/h1H,(H-,10,11,12);/q-1;+1
InChIKeyISNYQIVPHUCJRB-UHFFFAOYSA-N
MW269.21 g/mol
LogP-1.13
Rot. Bonds2

About potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide

potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide (PubChem CID 173133897) has the molecular formula C3H2F6KNO2S and a molecular weight of 269.21 g/mol. Its IUPAC name is potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide.

Molecular Properties

Compound Namepotassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide
PubChem CID173133897
Molecular FormulaC3H2F6KNO2S
Molecular Weight269.21 g/mol
Exact Mass268.93
IUPAC Namepotassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)C(F)(F)C(F)C(F)(F)F
InChIInChI=1S/C3H2F6NO2S.K/c4-1(2(5,6)7)3(8,9)13(10,11)12;/h1H,(H-,10,11,12);/q-1;+1
InChIKeyISNYQIVPHUCJRB-UHFFFAOYSA-N
XLogP-1.13
TPSA57.94 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.21
LogP ≤ 5-1.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide?
The IUPAC name of potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide (CID 173133897) is potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide.
What is the SMILES notation for potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide?
The canonical SMILES for potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide is [K+].[NH-]S(=O)(=O)C(F)(F)C(F)C(F)(F)F.
What is the InChIKey of potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide?
The InChIKey is ISNYQIVPHUCJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2F6NO2S.K/c4-1(2(5,6)7)3(8,9)13(10,11)12;/h1H,(H-,10,11,12);/q-1;+1.
What are the key properties of potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide?
potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide has a molecular weight of 269.21 g/mol, XLogP of -1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1,1,2,3,3,3-hexafluoropropylsulfonylazanide is sourced from PubChem (CID 173133897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).