C5H6F6O3S — CID 98041542
[(3S)-2,2,3,4,4,4-hexafluorobutyl] methanesulfonate (PubChem CID 98041542) has the molecular formula C5H6F6O3S and a molecular weight of 260.15 g/mol. Its IUPAC name is [(3S)-2,2,3,4,4,4-hexafluorobutyl] methanesulfonate.
| Compound Name | [(3S)-2,2,3,4,4,4-hexafluorobutyl] methanesulfonate |
|---|---|
| PubChem CID | 98041542 |
| Molecular Formula | C5H6F6O3S |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | [(3S)-2,2,3,4,4,4-hexafluorobutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(F)(F)[C@H](F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6O3S/c1-15(12,13)14-2-4(7,8)3(6)5(9,10)11/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | YUVQDSXGLUFTBE-VKHMYHEASA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|