C13H10F18O3 — CID 99769513
(2R)-4-[bis[(3R)-2,2,3,4,4,4-hexafluorobutoxy]methoxy]-1,1,1,2,3,3-hexafluorobutane (PubChem CID 99769513) has the molecular formula C13H10F18O3 and a molecular weight of 556.18 g/mol. Its IUPAC name is (2R)-4-[bis[(3R)-2,2,3,4,4,4-hexafluorobutoxy]methoxy]-1,1,1,2,3,3-hexafluorobutane.
| Compound Name | (2R)-4-[bis[(3R)-2,2,3,4,4,4-hexafluorobutoxy]methoxy]-1,1,1,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 99769513 |
| Molecular Formula | C13H10F18O3 |
| Molecular Weight | 556.18 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | (2R)-4-[bis[(3R)-2,2,3,4,4,4-hexafluorobutoxy]methoxy]-1,1,1,2,3,3-hexafluorobutane |
| SMILES | F[C@@H](C(F)(F)F)C(F)(F)COC(OCC(F)(F)[C@@H](F)C(F)(F)F)OCC(F)(F)[C@@H](F)C(F)(F)F |
| InChI | InChI=1S/C13H10F18O3/c14-4(11(23,24)25)8(17,18)1-32-7(33-2-9(19,20)5(15)12(26,27)28)34-3-10(21,22)6(16)13(29,30)31/h4-7H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | DVVBYYLMMRQXFU-HSUXUTPPSA-N |
| XLogP | 5.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.18 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|