C10H16F6O2 — CID 98041582
(2S)-4-[(1S)-1-butoxyethoxy]-1,1,1,2,3,3-hexafluorobutane (PubChem CID 98041582) has the molecular formula C10H16F6O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is (2S)-4-[(1S)-1-butoxyethoxy]-1,1,1,2,3,3-hexafluorobutane.
| Compound Name | (2S)-4-[(1S)-1-butoxyethoxy]-1,1,1,2,3,3-hexafluorobutane |
|---|---|
| PubChem CID | 98041582 |
| Molecular Formula | C10H16F6O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2S)-4-[(1S)-1-butoxyethoxy]-1,1,1,2,3,3-hexafluorobutane |
| SMILES | CCCCO[C@H](C)OCC(F)(F)[C@H](F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6O2/c1-3-4-5-17-7(2)18-6-9(12,13)8(11)10(14,15)16/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | MHWJJEAAUALWDP-YUMQZZPRSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|