C12H15F11O2 — CID 98454618
6-[(1S)-1-butoxyethoxy]-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane (PubChem CID 98454618) has the molecular formula C12H15F11O2 and a molecular weight of 400.23 g/mol. Its IUPAC name is 6-[(1S)-1-butoxyethoxy]-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane.
| Compound Name | 6-[(1S)-1-butoxyethoxy]-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane |
|---|---|
| PubChem CID | 98454618 |
| Molecular Formula | C12H15F11O2 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 6-[(1S)-1-butoxyethoxy]-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane |
| SMILES | CCCCO[C@H](C)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F11O2/c1-3-4-5-24-7(2)25-6-8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | FALRNNRIEOOHTH-ZETCQYMHSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|