C11H14F10O3 — CID 18995413
2-(1-butoxyethoxy)-1,1,2,3,3,4,4,5,5,5-decafluoropentan-1-ol (PubChem CID 18995413) has the molecular formula C11H14F10O3 and a molecular weight of 384.21 g/mol. Its IUPAC name is 2-(1-butoxyethoxy)-1,1,2,3,3,4,4,5,5,5-decafluoropentan-1-ol.
| Compound Name | 2-(1-butoxyethoxy)-1,1,2,3,3,4,4,5,5,5-decafluoropentan-1-ol |
|---|---|
| PubChem CID | 18995413 |
| Molecular Formula | C11H14F10O3 |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-(1-butoxyethoxy)-1,1,2,3,3,4,4,5,5,5-decafluoropentan-1-ol |
| SMILES | CCCCOC(C)OC(F)(C(O)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F10O3/c1-3-4-5-23-6(2)24-9(16,11(20,21)22)7(12,13)8(14,15)10(17,18)19/h6,22H,3-5H2,1-2H3 |
| InChIKey | ABGNQDNEFDAPJA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|