C14H15F13O3S — CID 18920732
butyl 2-hydroxy-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanyl)acetate (PubChem CID 18920732) has the molecular formula C14H15F13O3S and a molecular weight of 510.31 g/mol. Its IUPAC name is butyl 2-hydroxy-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanyl)acetate.
| Compound Name | butyl 2-hydroxy-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 18920732 |
| Molecular Formula | C14H15F13O3S |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | butyl 2-hydroxy-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-ylsulfanyl)acetate |
| SMILES | CCCCOC(=O)C(O)SC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F13O3S/c1-3-4-5-30-7(28)8(29)31-6(2)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h6,8,29H,3-5H2,1-2H3 |
| InChIKey | SWSPGVABJCMVLU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|