C9H9F11O — CID 151204416
2-butoxy-1,1,1,2,3,3,4,4,5,5,5-undecafluoropentane (PubChem CID 151204416) has the molecular formula C9H9F11O and a molecular weight of 342.15 g/mol. Its IUPAC name is 2-butoxy-1,1,1,2,3,3,4,4,5,5,5-undecafluoropentane.
| Compound Name | 2-butoxy-1,1,1,2,3,3,4,4,5,5,5-undecafluoropentane |
|---|---|
| PubChem CID | 151204416 |
| Molecular Formula | C9H9F11O |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-butoxy-1,1,1,2,3,3,4,4,5,5,5-undecafluoropentane |
| SMILES | CCCCOC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F11O/c1-2-3-4-21-7(14,9(18,19)20)5(10,11)6(12,13)8(15,16)17/h2-4H2,1H3 |
| InChIKey | NIZBUQYINQADIS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|