C11H9F15O — CID 150873626
2-butoxy-1,1,1,2,3,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexane (PubChem CID 150873626) has the molecular formula C11H9F15O and a molecular weight of 442.16 g/mol. Its IUPAC name is 2-butoxy-1,1,1,2,3,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexane.
| Compound Name | 2-butoxy-1,1,1,2,3,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 150873626 |
| Molecular Formula | C11H9F15O |
| Molecular Weight | 442.16 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-butoxy-1,1,1,2,3,3,4,4,5,6,6,6-dodecafluoro-5-(trifluoromethyl)hexane |
| SMILES | CCCCOC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F15O/c1-2-3-4-27-8(17,11(24,25)26)7(15,16)6(13,14)5(12,9(18,19)20)10(21,22)23/h2-4H2,1H3 |
| InChIKey | KUOAFGYIQVTSEW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|