C20H20F24O2 — CID 123414825
3-butoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane (PubChem CID 123414825) has the molecular formula C20H20F24O2 and a molecular weight of 748.33 g/mol. Its IUPAC name is 3-butoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 3-butoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 123414825 |
| Molecular Formula | C20H20F24O2 |
| Molecular Weight | 748.33 g/mol |
| Exact Mass | 748.11 |
| IUPAC Name | 3-butoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
| SMILES | CCCCOC(F)(C(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F.CCCCOC(F)(C(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C10H10F12O/c2*1-2-3-4-23-6(12,5(11)7(13,14)15)8(16,9(17,18)19)10(20,21)22/h2*5H,2-4H2,1H3 |
| InChIKey | ZTZNZRLHDLXNFV-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.33 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|