C9H10AsF11 — CID 173244624
butyl-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]arsane (PubChem CID 173244624) has the molecular formula C9H10AsF11 and a molecular weight of 402.08 g/mol. Its IUPAC name is butyl-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]arsane.
| Compound Name | butyl-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]arsane |
|---|---|
| PubChem CID | 173244624 |
| Molecular Formula | C9H10AsF11 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | butyl-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]arsane |
| SMILES | CCCC[AsH]C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10AsF11/c1-2-3-4-10-7(14,15)6(12,13)5(11,8(16,17)18)9(19,20)21/h10H,2-4H2,1H3 |
| InChIKey | LQEWJKYRFYGIRN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|