C46H78F16 — CID 58991617
11,11,12,13,14,15,15-heptafluoro-10,16-di(nonyl)-12,13,14-tris(trifluoromethyl)pentacosane (PubChem CID 58991617) has the molecular formula C46H78F16 and a molecular weight of 935.10 g/mol. Its IUPAC name is 11,11,12,13,14,15,15-heptafluoro-10,16-di(nonyl)-12,13,14-tris(trifluoromethyl)pentacosane.
| Compound Name | 11,11,12,13,14,15,15-heptafluoro-10,16-di(nonyl)-12,13,14-tris(trifluoromethyl)pentacosane |
|---|---|
| PubChem CID | 58991617 |
| Molecular Formula | C46H78F16 |
| Molecular Weight | 935.10 g/mol |
| Exact Mass | 934.58 |
| IUPAC Name | 11,11,12,13,14,15,15-heptafluoro-10,16-di(nonyl)-12,13,14-tris(trifluoromethyl)pentacosane |
| SMILES | CCCCCCCCCC(CCCCCCCCC)C(F)(F)C(F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)C(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C46H78F16/c1-5-9-13-17-21-25-29-33-37(34-30-26-22-18-14-10-6-2)39(47,48)41(51,44(54,55)56)43(53,46(60,61)62)42(52,45(57,58)59)40(49,50)38(35-31-27-23-19-15-11-7-3)36-32-28-24-20-16-12-8-4/h37-38H,5-36H2,1-4H3 |
| InChIKey | IFPRSXUIJUNUFP-UHFFFAOYSA-N |
| XLogP | 19.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 38 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.10 |
| LogP ≤ 5 | 19.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|